About (2-ethyl-4-methyl-1,3-oxazol-5-yl)methanamine;hydrochloride
(2-ethyl-4-methyl-1,3-oxazol-5-yl)methanamine;hydrochloride (PubChem CID 119031976) has the molecular formula C7H13ClN2O
and a molecular weight of 176.65 g/mol. Its IUPAC name is (2-ethyl-4-methyl-1,3-oxazol-5-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (2-ethyl-4-methyl-1,3-oxazol-5-yl)methanamine;hydrochloride |
| PubChem CID | 119031976 |
| Molecular Formula | C7H13ClN2O |
| Molecular Weight | 176.65 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | (2-ethyl-4-methyl-1,3-oxazol-5-yl)methanamine;hydrochloride |
| SMILES | CCc1nc(C)c(CN)o1.Cl |
| InChI | InChI=1S/C7H12N2O.ClH/c1-3-7-9-5(2)6(4-8)10-7;/h3-4,8H2,1-2H3;1H |
| InChIKey | ANYNVJVGLLUJRL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.65 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-ethyl-4-methyl-1,3-oxazol-5-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-4-methyl-1,3-oxazol-5-yl)methanamine;hydrochloride?
The IUPAC name of (2-ethyl-4-methyl-1,3-oxazol-5-yl)methanamine;hydrochloride (CID 119031976) is (2-ethyl-4-methyl-1,3-oxazol-5-yl)methanamine;hydrochloride.
What is the SMILES notation for (2-ethyl-4-methyl-1,3-oxazol-5-yl)methanamine;hydrochloride?
The canonical SMILES for (2-ethyl-4-methyl-1,3-oxazol-5-yl)methanamine;hydrochloride is CCc1nc(C)c(CN)o1.Cl.
What is the InChIKey of (2-ethyl-4-methyl-1,3-oxazol-5-yl)methanamine;hydrochloride?
The InChIKey is ANYNVJVGLLUJRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O.ClH/c1-3-7-9-5(2)6(4-8)10-7;/h3-4,8H2,1-2H3;1H.
What are the key properties of (2-ethyl-4-methyl-1,3-oxazol-5-yl)methanamine;hydrochloride?
(2-ethyl-4-methyl-1,3-oxazol-5-yl)methanamine;hydrochloride has a molecular weight of 176.65 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-4-methyl-1,3-oxazol-5-yl)methanamine;hydrochloride is sourced from PubChem (CID 119031976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).