C11H15ClN2O2 — CID 119032033
3-[4-(1-aminoethyl)phenyl]-1,3-oxazolidin-2-one;hydrochloride (PubChem CID 119032033) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 3-[4-(1-aminoethyl)phenyl]-1,3-oxazolidin-2-one;hydrochloride.
| Compound Name | 3-[4-(1-aminoethyl)phenyl]-1,3-oxazolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119032033 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 3-[4-(1-aminoethyl)phenyl]-1,3-oxazolidin-2-one;hydrochloride |
| SMILES | CC(N)c1ccc(N2CCOC2=O)cc1.Cl |
| InChI | InChI=1S/C11H14N2O2.ClH/c1-8(12)9-2-4-10(5-3-9)13-6-7-15-11(13)14;/h2-5,8H,6-7,12H2,1H3;1H |
| InChIKey | GRVWAQHPQMPJEN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |