C7H13NO3 — CID 119032100
2-amino-2-(1-methoxycyclobutyl)acetic acid (PubChem CID 119032100) has the molecular formula C7H13NO3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-amino-2-(1-methoxycyclobutyl)acetic acid.
| Compound Name | 2-amino-2-(1-methoxycyclobutyl)acetic acid |
|---|---|
| PubChem CID | 119032100 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 2-amino-2-(1-methoxycyclobutyl)acetic acid |
| SMILES | COC1(C(N)C(=O)O)CCC1 |
| InChI | InChI=1S/C7H13NO3/c1-11-7(3-2-4-7)5(8)6(9)10/h5H,2-4,8H2,1H3,(H,9,10) |
| InChIKey | LEOFPCKFKFVFOL-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |