About piperidin-4-yl N,N-dimethylcarbamate;hydrochloride
piperidin-4-yl N,N-dimethylcarbamate;hydrochloride (PubChem CID 119032139) has the molecular formula C8H17ClN2O2
and a molecular weight of 208.69 g/mol. Its IUPAC name is piperidin-4-yl N,N-dimethylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | piperidin-4-yl N,N-dimethylcarbamate;hydrochloride |
| PubChem CID | 119032139 |
| Molecular Formula | C8H17ClN2O2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | piperidin-4-yl N,N-dimethylcarbamate;hydrochloride |
| SMILES | CN(C)C(=O)OC1CCNCC1.Cl |
| InChI | InChI=1S/C8H16N2O2.ClH/c1-10(2)8(11)12-7-3-5-9-6-4-7;/h7,9H,3-6H2,1-2H3;1H |
| InChIKey | MWOZRNUJYUNCCO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidin-4-yl N,N-dimethylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl N,N-dimethylcarbamate;hydrochloride?
The IUPAC name of piperidin-4-yl N,N-dimethylcarbamate;hydrochloride (CID 119032139) is piperidin-4-yl N,N-dimethylcarbamate;hydrochloride.
What is the SMILES notation for piperidin-4-yl N,N-dimethylcarbamate;hydrochloride?
The canonical SMILES for piperidin-4-yl N,N-dimethylcarbamate;hydrochloride is CN(C)C(=O)OC1CCNCC1.Cl.
What is the InChIKey of piperidin-4-yl N,N-dimethylcarbamate;hydrochloride?
The InChIKey is MWOZRNUJYUNCCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2.ClH/c1-10(2)8(11)12-7-3-5-9-6-4-7;/h7,9H,3-6H2,1-2H3;1H.
What are the key properties of piperidin-4-yl N,N-dimethylcarbamate;hydrochloride?
piperidin-4-yl N,N-dimethylcarbamate;hydrochloride has a molecular weight of 208.69 g/mol, XLogP of 0.86, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl N,N-dimethylcarbamate;hydrochloride is sourced from PubChem (CID 119032139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).