About 4-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylpyrazole-3-carboxamide
4-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylpyrazole-3-carboxamide (PubChem CID 119032239) has the molecular formula C15H17N3O4S
and a molecular weight of 335.38 g/mol. Its IUPAC name is 4-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylpyrazole-3-carboxamide |
| PubChem CID | 119032239 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 4-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylpyrazole-3-carboxamide |
| SMILES | CC1(NC(=O)c2nn(-c3ccccc3)cc2O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H17N3O4S/c1-15(7-8-23(21,22)10-15)16-14(20)13-12(19)9-18(17-13)11-5-3-2-4-6-11/h2-6,9,19H,7-8,10H2,1H3,(H,16,20) |
| InChIKey | ADHLTYMEOUSJTG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylpyrazole-3-carboxamide?
The IUPAC name of 4-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylpyrazole-3-carboxamide (CID 119032239) is 4-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylpyrazole-3-carboxamide.
What is the SMILES notation for 4-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylpyrazole-3-carboxamide?
The canonical SMILES for 4-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylpyrazole-3-carboxamide is CC1(NC(=O)c2nn(-c3ccccc3)cc2O)CCS(=O)(=O)C1.
What is the InChIKey of 4-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylpyrazole-3-carboxamide?
The InChIKey is ADHLTYMEOUSJTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O4S/c1-15(7-8-23(21,22)10-15)16-14(20)13-12(19)9-18(17-13)11-5-3-2-4-6-11/h2-6,9,19H,7-8,10H2,1H3,(H,16,20).
What are the key properties of 4-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylpyrazole-3-carboxamide?
4-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylpyrazole-3-carboxamide has a molecular weight of 335.38 g/mol, XLogP of 0.88, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-N-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylpyrazole-3-carboxamide is sourced from PubChem (CID 119032239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).