About 3-methyl-N-(5-phenyl-1,2-oxazol-3-yl)-2,3-dihydro-1-benzofuran-2-carboxamide
3-methyl-N-(5-phenyl-1,2-oxazol-3-yl)-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 119032993) has the molecular formula C19H16N2O3
and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-methyl-N-(5-phenyl-1,2-oxazol-3-yl)-2,3-dihydro-1-benzofuran-2-carboxamide.
Molecular Properties
| Compound Name | 3-methyl-N-(5-phenyl-1,2-oxazol-3-yl)-2,3-dihydro-1-benzofuran-2-carboxamide |
| PubChem CID | 119032993 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 3-methyl-N-(5-phenyl-1,2-oxazol-3-yl)-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | CC1c2ccccc2OC1C(=O)Nc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C19H16N2O3/c1-12-14-9-5-6-10-15(14)23-18(12)19(22)20-17-11-16(24-21-17)13-7-3-2-4-8-13/h2-12,18H,1H3,(H,20,21,22) |
| InChIKey | HYRFNZNNJXBJNS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-N-(5-phenyl-1,2-oxazol-3-yl)-2,3-dihydro-1-benzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-(5-phenyl-1,2-oxazol-3-yl)-2,3-dihydro-1-benzofuran-2-carboxamide?
The IUPAC name of 3-methyl-N-(5-phenyl-1,2-oxazol-3-yl)-2,3-dihydro-1-benzofuran-2-carboxamide (CID 119032993) is 3-methyl-N-(5-phenyl-1,2-oxazol-3-yl)-2,3-dihydro-1-benzofuran-2-carboxamide.
What is the SMILES notation for 3-methyl-N-(5-phenyl-1,2-oxazol-3-yl)-2,3-dihydro-1-benzofuran-2-carboxamide?
The canonical SMILES for 3-methyl-N-(5-phenyl-1,2-oxazol-3-yl)-2,3-dihydro-1-benzofuran-2-carboxamide is CC1c2ccccc2OC1C(=O)Nc1cc(-c2ccccc2)on1.
What is the InChIKey of 3-methyl-N-(5-phenyl-1,2-oxazol-3-yl)-2,3-dihydro-1-benzofuran-2-carboxamide?
The InChIKey is HYRFNZNNJXBJNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O3/c1-12-14-9-5-6-10-15(14)23-18(12)19(22)20-17-11-16(24-21-17)13-7-3-2-4-8-13/h2-12,18H,1H3,(H,20,21,22).
What are the key properties of 3-methyl-N-(5-phenyl-1,2-oxazol-3-yl)-2,3-dihydro-1-benzofuran-2-carboxamide?
3-methyl-N-(5-phenyl-1,2-oxazol-3-yl)-2,3-dihydro-1-benzofuran-2-carboxamide has a molecular weight of 320.35 g/mol, XLogP of 3.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-(5-phenyl-1,2-oxazol-3-yl)-2,3-dihydro-1-benzofuran-2-carboxamide is sourced from PubChem (CID 119032993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).