C19H23N5O3S — CID 119033051
3-[1-(1H-benzimidazol-2-yl)ethyl]-1-[2-(dimethylsulfamoyl)phenyl]-1-methylurea (PubChem CID 119033051) has the molecular formula C19H23N5O3S and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-[1-(1H-benzimidazol-2-yl)ethyl]-1-[2-(dimethylsulfamoyl)phenyl]-1-methylurea.
| Compound Name | 3-[1-(1H-benzimidazol-2-yl)ethyl]-1-[2-(dimethylsulfamoyl)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 119033051 |
| Molecular Formula | C19H23N5O3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 3-[1-(1H-benzimidazol-2-yl)ethyl]-1-[2-(dimethylsulfamoyl)phenyl]-1-methylurea |
| SMILES | CC(NC(=O)N(C)c1ccccc1S(=O)(=O)N(C)C)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H23N5O3S/c1-13(18-21-14-9-5-6-10-15(14)22-18)20-19(25)24(4)16-11-7-8-12-17(16)28(26,27)23(2)3/h5-13H,1-4H3,(H,20,25)(H,21,22) |
| InChIKey | QXUTUWHSIJEDQQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |