C14H18N4OS3 — CID 119033103
3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-N-(thiolan-2-ylmethyl)propanamide (PubChem CID 119033103) has the molecular formula C14H18N4OS3 and a molecular weight of 354.53 g/mol. Its IUPAC name is 3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-N-(thiolan-2-ylmethyl)propanamide.
| Compound Name | 3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-N-(thiolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 119033103 |
| Molecular Formula | C14H18N4OS3 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-N-(thiolan-2-ylmethyl)propanamide |
| SMILES | O=C(CCn1c(-c2cccs2)n[nH]c1=S)NCC1CCCS1 |
| InChI | InChI=1S/C14H18N4OS3/c19-12(15-9-10-3-1-7-21-10)5-6-18-13(16-17-14(18)20)11-4-2-8-22-11/h2,4,8,10H,1,3,5-7,9H2,(H,15,19)(H,17,20) |
| InChIKey | LDCLTGYMTLLSQH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|