About N-[(1R,2R)-2-aminocyclohexyl]cyclopropanesulfonamide;hydrochloride
N-[(1R,2R)-2-aminocyclohexyl]cyclopropanesulfonamide;hydrochloride (PubChem CID 119033460) has the molecular formula C9H19ClN2O2S
and a molecular weight of 254.78 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]cyclopropanesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]cyclopropanesulfonamide;hydrochloride |
| PubChem CID | 119033460 |
| Molecular Formula | C9H19ClN2O2S |
| Molecular Weight | 254.78 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]cyclopropanesulfonamide;hydrochloride |
| SMILES | Cl.N[C@@H]1CCCC[C@H]1NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C9H18N2O2S.ClH/c10-8-3-1-2-4-9(8)11-14(12,13)7-5-6-7;/h7-9,11H,1-6,10H2;1H/t8-,9-;/m1./s1 |
| InChIKey | IWJCMADBULVEGX-VTLYIQCISA-N |
| XLogP | 0.76 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.78 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R,2R)-2-aminocyclohexyl]cyclopropanesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2R)-2-aminocyclohexyl]cyclopropanesulfonamide;hydrochloride?
The IUPAC name of N-[(1R,2R)-2-aminocyclohexyl]cyclopropanesulfonamide;hydrochloride (CID 119033460) is N-[(1R,2R)-2-aminocyclohexyl]cyclopropanesulfonamide;hydrochloride.
What is the SMILES notation for N-[(1R,2R)-2-aminocyclohexyl]cyclopropanesulfonamide;hydrochloride?
The canonical SMILES for N-[(1R,2R)-2-aminocyclohexyl]cyclopropanesulfonamide;hydrochloride is Cl.N[C@@H]1CCCC[C@H]1NS(=O)(=O)C1CC1.
What is the InChIKey of N-[(1R,2R)-2-aminocyclohexyl]cyclopropanesulfonamide;hydrochloride?
The InChIKey is IWJCMADBULVEGX-VTLYIQCISA-N. The full InChI is InChI=1S/C9H18N2O2S.ClH/c10-8-3-1-2-4-9(8)11-14(12,13)7-5-6-7;/h7-9,11H,1-6,10H2;1H/t8-,9-;/m1./s1.
What are the key properties of N-[(1R,2R)-2-aminocyclohexyl]cyclopropanesulfonamide;hydrochloride?
N-[(1R,2R)-2-aminocyclohexyl]cyclopropanesulfonamide;hydrochloride has a molecular weight of 254.78 g/mol, XLogP of 0.76, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2R)-2-aminocyclohexyl]cyclopropanesulfonamide;hydrochloride is sourced from PubChem (CID 119033460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).