C19H24ClN3O2 — CID 119033797
2-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 119033797) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is 2-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | 2-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 119033797 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | CN1CCCC(CN2C(=O)C3CCCN3C2=O)C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H24ClN3O2/c1-21-9-3-6-14(17(21)13-5-2-7-15(20)11-13)12-23-18(24)16-8-4-10-22(16)19(23)25/h2,5,7,11,14,16-17H,3-4,6,8-10,12H2,1H3 |
| InChIKey | YSQMNLRZNZMJJE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|