C17H22ClN3S — CID 119034119
2-[(5-phenyl-1,3-thiazol-2-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride (PubChem CID 119034119) has the molecular formula C17H22ClN3S and a molecular weight of 335.90 g/mol. Its IUPAC name is 2-[(5-phenyl-1,3-thiazol-2-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride.
| Compound Name | 2-[(5-phenyl-1,3-thiazol-2-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 119034119 |
| Molecular Formula | C17H22ClN3S |
| Molecular Weight | 335.90 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[(5-phenyl-1,3-thiazol-2-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride |
| SMILES | Cl.NC1CCC2CN(Cc3ncc(-c4ccccc4)s3)CC12 |
| InChI | InChI=1S/C17H21N3S.ClH/c18-15-7-6-13-9-20(10-14(13)15)11-17-19-8-16(21-17)12-4-2-1-3-5-12;/h1-5,8,13-15H,6-7,9-11,18H2;1H |
| InChIKey | QFLQFBOEKXVRFA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.90 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |