About 3-acetamido-N-[1-(3,4-dichlorophenyl)ethyl]azetidine-1-carboxamide
3-acetamido-N-[1-(3,4-dichlorophenyl)ethyl]azetidine-1-carboxamide (PubChem CID 119034743) has the molecular formula C14H17Cl2N3O2
and a molecular weight of 330.22 g/mol. Its IUPAC name is 3-acetamido-N-[1-(3,4-dichlorophenyl)ethyl]azetidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-acetamido-N-[1-(3,4-dichlorophenyl)ethyl]azetidine-1-carboxamide |
| PubChem CID | 119034743 |
| Molecular Formula | C14H17Cl2N3O2 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 3-acetamido-N-[1-(3,4-dichlorophenyl)ethyl]azetidine-1-carboxamide |
| SMILES | CC(=O)NC1CN(C(=O)NC(C)c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H17Cl2N3O2/c1-8(10-3-4-12(15)13(16)5-10)17-14(21)19-6-11(7-19)18-9(2)20/h3-5,8,11H,6-7H2,1-2H3,(H,17,21)(H,18,20) |
| InChIKey | PBXJJBLBDWBLKB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-acetamido-N-[1-(3,4-dichlorophenyl)ethyl]azetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetamido-N-[1-(3,4-dichlorophenyl)ethyl]azetidine-1-carboxamide?
The IUPAC name of 3-acetamido-N-[1-(3,4-dichlorophenyl)ethyl]azetidine-1-carboxamide (CID 119034743) is 3-acetamido-N-[1-(3,4-dichlorophenyl)ethyl]azetidine-1-carboxamide.
What is the SMILES notation for 3-acetamido-N-[1-(3,4-dichlorophenyl)ethyl]azetidine-1-carboxamide?
The canonical SMILES for 3-acetamido-N-[1-(3,4-dichlorophenyl)ethyl]azetidine-1-carboxamide is CC(=O)NC1CN(C(=O)NC(C)c2ccc(Cl)c(Cl)c2)C1.
What is the InChIKey of 3-acetamido-N-[1-(3,4-dichlorophenyl)ethyl]azetidine-1-carboxamide?
The InChIKey is PBXJJBLBDWBLKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2N3O2/c1-8(10-3-4-12(15)13(16)5-10)17-14(21)19-6-11(7-19)18-9(2)20/h3-5,8,11H,6-7H2,1-2H3,(H,17,21)(H,18,20).
What are the key properties of 3-acetamido-N-[1-(3,4-dichlorophenyl)ethyl]azetidine-1-carboxamide?
3-acetamido-N-[1-(3,4-dichlorophenyl)ethyl]azetidine-1-carboxamide has a molecular weight of 330.22 g/mol, XLogP of 2.58, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetamido-N-[1-(3,4-dichlorophenyl)ethyl]azetidine-1-carboxamide is sourced from PubChem (CID 119034743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).