C18H28N2O2 — CID 119035220
N,N'-di(cyclohex-2-en-1-yl)-2,3-dimethylbutanediamide (PubChem CID 119035220) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is N,N'-di(cyclohex-2-en-1-yl)-2,3-dimethylbutanediamide.
| Compound Name | N,N'-di(cyclohex-2-en-1-yl)-2,3-dimethylbutanediamide |
|---|---|
| PubChem CID | 119035220 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | N,N'-di(cyclohex-2-en-1-yl)-2,3-dimethylbutanediamide |
| SMILES | CC(C(=O)NC1C=CCCC1)C(C)C(=O)NC1C=CCCC1 |
| InChI | InChI=1S/C18H28N2O2/c1-13(17(21)19-15-9-5-3-6-10-15)14(2)18(22)20-16-11-7-4-8-12-16/h5,7,9,11,13-16H,3-4,6,8,10,12H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | UCVYEZNIQOEJSE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|