C16H23F3N4O — CID 119035685
1-[[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]methyl]-3-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 119035685) has the molecular formula C16H23F3N4O and a molecular weight of 344.38 g/mol. Its IUPAC name is 1-[[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]methyl]-3-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-[[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]methyl]-3-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 119035685 |
| Molecular Formula | C16H23F3N4O |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]methyl]-3-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | OC1(CNc2cc(N3CCCC3)ncn2)CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C16H23F3N4O/c17-16(18,19)12-4-3-5-15(24,9-12)10-20-13-8-14(22-11-21-13)23-6-1-2-7-23/h8,11-12,24H,1-7,9-10H2,(H,20,21,22) |
| InChIKey | XDUHDBZRTFMWRB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |