C14H25N3O4S2 — CID 119036317
1-[5-[[4-(3-methoxypropylsulfonyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]ethanol (PubChem CID 119036317) has the molecular formula C14H25N3O4S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-[5-[[4-(3-methoxypropylsulfonyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]ethanol.
| Compound Name | 1-[5-[[4-(3-methoxypropylsulfonyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 119036317 |
| Molecular Formula | C14H25N3O4S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-[5-[[4-(3-methoxypropylsulfonyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]ethanol |
| SMILES | COCCCS(=O)(=O)N1CCN(Cc2cnc(C(C)O)s2)CC1 |
| InChI | InChI=1S/C14H25N3O4S2/c1-12(18)14-15-10-13(22-14)11-16-4-6-17(7-5-16)23(19,20)9-3-8-21-2/h10,12,18H,3-9,11H2,1-2H3 |
| InChIKey | QXBBMLTYMHQMFW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|