About 2-(7-cyano-1-oxa-8-azaspiro[5.5]undecan-8-yl)-N-methyl-N-(1,3-thiazol-2-yl)acetamide
2-(7-cyano-1-oxa-8-azaspiro[5.5]undecan-8-yl)-N-methyl-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 119036801) has the molecular formula C16H22N4O2S
and a molecular weight of 334.45 g/mol. Its IUPAC name is 2-(7-cyano-1-oxa-8-azaspiro[5.5]undecan-8-yl)-N-methyl-N-(1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(7-cyano-1-oxa-8-azaspiro[5.5]undecan-8-yl)-N-methyl-N-(1,3-thiazol-2-yl)acetamide |
| PubChem CID | 119036801 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-(7-cyano-1-oxa-8-azaspiro[5.5]undecan-8-yl)-N-methyl-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CN(C(=O)CN1CCCC2(CCCCO2)C1C#N)c1nccs1 |
| InChI | InChI=1S/C16H22N4O2S/c1-19(15-18-7-10-23-15)14(21)12-20-8-4-6-16(13(20)11-17)5-2-3-9-22-16/h7,10,13H,2-6,8-9,12H2,1H3 |
| InChIKey | XGRDZYDTPADKIE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(7-cyano-1-oxa-8-azaspiro[5.5]undecan-8-yl)-N-methyl-N-(1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-cyano-1-oxa-8-azaspiro[5.5]undecan-8-yl)-N-methyl-N-(1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-(7-cyano-1-oxa-8-azaspiro[5.5]undecan-8-yl)-N-methyl-N-(1,3-thiazol-2-yl)acetamide (CID 119036801) is 2-(7-cyano-1-oxa-8-azaspiro[5.5]undecan-8-yl)-N-methyl-N-(1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-(7-cyano-1-oxa-8-azaspiro[5.5]undecan-8-yl)-N-methyl-N-(1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-(7-cyano-1-oxa-8-azaspiro[5.5]undecan-8-yl)-N-methyl-N-(1,3-thiazol-2-yl)acetamide is CN(C(=O)CN1CCCC2(CCCCO2)C1C#N)c1nccs1.
What is the InChIKey of 2-(7-cyano-1-oxa-8-azaspiro[5.5]undecan-8-yl)-N-methyl-N-(1,3-thiazol-2-yl)acetamide?
The InChIKey is XGRDZYDTPADKIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O2S/c1-19(15-18-7-10-23-15)14(21)12-20-8-4-6-16(13(20)11-17)5-2-3-9-22-16/h7,10,13H,2-6,8-9,12H2,1H3.
What are the key properties of 2-(7-cyano-1-oxa-8-azaspiro[5.5]undecan-8-yl)-N-methyl-N-(1,3-thiazol-2-yl)acetamide?
2-(7-cyano-1-oxa-8-azaspiro[5.5]undecan-8-yl)-N-methyl-N-(1,3-thiazol-2-yl)acetamide has a molecular weight of 334.45 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-cyano-1-oxa-8-azaspiro[5.5]undecan-8-yl)-N-methyl-N-(1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 119036801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).