C18H23N5O2 — CID 119037018
1-methyl-3-[2-oxo-2-[2-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]ethyl]urea (PubChem CID 119037018) has the molecular formula C18H23N5O2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-methyl-3-[2-oxo-2-[2-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]ethyl]urea.
| Compound Name | 1-methyl-3-[2-oxo-2-[2-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 119037018 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-methyl-3-[2-oxo-2-[2-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]ethyl]urea |
| SMILES | CNC(=O)NCC(=O)N1CCCCC1c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C18H23N5O2/c1-19-18(25)21-12-16(24)23-10-6-5-9-15(23)17-20-11-14(22-17)13-7-3-2-4-8-13/h2-4,7-8,11,15H,5-6,9-10,12H2,1H3,(H,20,22)(H2,19,21,25) |
| InChIKey | CLCKAWYSLFZZLK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |