C16H17N5O — CID 119037718
8-methoxy-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)quinolin-4-amine (PubChem CID 119037718) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 8-methoxy-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)quinolin-4-amine.
| Compound Name | 8-methoxy-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)quinolin-4-amine |
|---|---|
| PubChem CID | 119037718 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 8-methoxy-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)quinolin-4-amine |
| SMILES | COc1cccc2c(NC3CCCn4ncnc43)ccnc12 |
| InChI | InChI=1S/C16H17N5O/c1-22-14-6-2-4-11-12(7-8-17-15(11)14)20-13-5-3-9-21-16(13)18-10-19-21/h2,4,6-8,10,13H,3,5,9H2,1H3,(H,17,20) |
| InChIKey | LYTQRTOGWCPOQD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |