About N-ethyl-3-[2-(2-ethylmorpholin-4-yl)butanoylamino]-2,2-dimethylpropanamide
N-ethyl-3-[2-(2-ethylmorpholin-4-yl)butanoylamino]-2,2-dimethylpropanamide (PubChem CID 119038295) has the molecular formula C17H33N3O3
and a molecular weight of 327.47 g/mol. Its IUPAC name is N-ethyl-3-[2-(2-ethylmorpholin-4-yl)butanoylamino]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-ethyl-3-[2-(2-ethylmorpholin-4-yl)butanoylamino]-2,2-dimethylpropanamide |
| PubChem CID | 119038295 |
| Molecular Formula | C17H33N3O3 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.25 |
| IUPAC Name | N-ethyl-3-[2-(2-ethylmorpholin-4-yl)butanoylamino]-2,2-dimethylpropanamide |
| SMILES | CCNC(=O)C(C)(C)CNC(=O)C(CC)N1CCOC(CC)C1 |
| InChI | InChI=1S/C17H33N3O3/c1-6-13-11-20(9-10-23-13)14(7-2)15(21)19-12-17(4,5)16(22)18-8-3/h13-14H,6-12H2,1-5H3,(H,18,22)(H,19,21) |
| InChIKey | BOWBQKUJXAYVDP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-3-[2-(2-ethylmorpholin-4-yl)butanoylamino]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-[2-(2-ethylmorpholin-4-yl)butanoylamino]-2,2-dimethylpropanamide?
The IUPAC name of N-ethyl-3-[2-(2-ethylmorpholin-4-yl)butanoylamino]-2,2-dimethylpropanamide (CID 119038295) is N-ethyl-3-[2-(2-ethylmorpholin-4-yl)butanoylamino]-2,2-dimethylpropanamide.
What is the SMILES notation for N-ethyl-3-[2-(2-ethylmorpholin-4-yl)butanoylamino]-2,2-dimethylpropanamide?
The canonical SMILES for N-ethyl-3-[2-(2-ethylmorpholin-4-yl)butanoylamino]-2,2-dimethylpropanamide is CCNC(=O)C(C)(C)CNC(=O)C(CC)N1CCOC(CC)C1.
What is the InChIKey of N-ethyl-3-[2-(2-ethylmorpholin-4-yl)butanoylamino]-2,2-dimethylpropanamide?
The InChIKey is BOWBQKUJXAYVDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33N3O3/c1-6-13-11-20(9-10-23-13)14(7-2)15(21)19-12-17(4,5)16(22)18-8-3/h13-14H,6-12H2,1-5H3,(H,18,22)(H,19,21).
What are the key properties of N-ethyl-3-[2-(2-ethylmorpholin-4-yl)butanoylamino]-2,2-dimethylpropanamide?
N-ethyl-3-[2-(2-ethylmorpholin-4-yl)butanoylamino]-2,2-dimethylpropanamide has a molecular weight of 327.47 g/mol, XLogP of 1.15, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-[2-(2-ethylmorpholin-4-yl)butanoylamino]-2,2-dimethylpropanamide is sourced from PubChem (CID 119038295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).