C18H26N4O2Si — CID 119038571
N-[[dimethyl(phenyl)silyl]methyl]-3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carboxamide (PubChem CID 119038571) has the molecular formula C18H26N4O2Si and a molecular weight of 358.52 g/mol. Its IUPAC name is N-[[dimethyl(phenyl)silyl]methyl]-3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carboxamide.
| Compound Name | N-[[dimethyl(phenyl)silyl]methyl]-3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 119038571 |
| Molecular Formula | C18H26N4O2Si |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-[[dimethyl(phenyl)silyl]methyl]-3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carboxamide |
| SMILES | Cc1noc(C2CCCN(C(=O)NC[Si](C)(C)c3ccccc3)C2)n1 |
| InChI | InChI=1S/C18H26N4O2Si/c1-14-20-17(24-21-14)15-8-7-11-22(12-15)18(23)19-13-25(2,3)16-9-5-4-6-10-16/h4-6,9-10,15H,7-8,11-13H2,1-3H3,(H,19,23) |
| InChIKey | BTAYOBXJGLPNJX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|