About 3-[(2,5-difluorophenyl)sulfinylmethyl]-1-(4-fluorophenyl)pyrazole
3-[(2,5-difluorophenyl)sulfinylmethyl]-1-(4-fluorophenyl)pyrazole (PubChem CID 119039085) has the molecular formula C16H11F3N2OS
and a molecular weight of 336.34 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)sulfinylmethyl]-1-(4-fluorophenyl)pyrazole.
Molecular Properties
| Compound Name | 3-[(2,5-difluorophenyl)sulfinylmethyl]-1-(4-fluorophenyl)pyrazole |
| PubChem CID | 119039085 |
| Molecular Formula | C16H11F3N2OS |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 3-[(2,5-difluorophenyl)sulfinylmethyl]-1-(4-fluorophenyl)pyrazole |
| SMILES | O=S(Cc1ccn(-c2ccc(F)cc2)n1)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H11F3N2OS/c17-11-1-4-14(5-2-11)21-8-7-13(20-21)10-23(22)16-9-12(18)3-6-15(16)19/h1-9H,10H2 |
| InChIKey | DJHQQTHMZMPBQT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2,5-difluorophenyl)sulfinylmethyl]-1-(4-fluorophenyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,5-difluorophenyl)sulfinylmethyl]-1-(4-fluorophenyl)pyrazole?
The IUPAC name of 3-[(2,5-difluorophenyl)sulfinylmethyl]-1-(4-fluorophenyl)pyrazole (CID 119039085) is 3-[(2,5-difluorophenyl)sulfinylmethyl]-1-(4-fluorophenyl)pyrazole.
What is the SMILES notation for 3-[(2,5-difluorophenyl)sulfinylmethyl]-1-(4-fluorophenyl)pyrazole?
The canonical SMILES for 3-[(2,5-difluorophenyl)sulfinylmethyl]-1-(4-fluorophenyl)pyrazole is O=S(Cc1ccn(-c2ccc(F)cc2)n1)c1cc(F)ccc1F.
What is the InChIKey of 3-[(2,5-difluorophenyl)sulfinylmethyl]-1-(4-fluorophenyl)pyrazole?
The InChIKey is DJHQQTHMZMPBQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F3N2OS/c17-11-1-4-14(5-2-11)21-8-7-13(20-21)10-23(22)16-9-12(18)3-6-15(16)19/h1-9H,10H2.
What are the key properties of 3-[(2,5-difluorophenyl)sulfinylmethyl]-1-(4-fluorophenyl)pyrazole?
3-[(2,5-difluorophenyl)sulfinylmethyl]-1-(4-fluorophenyl)pyrazole has a molecular weight of 336.34 g/mol, XLogP of 3.60, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,5-difluorophenyl)sulfinylmethyl]-1-(4-fluorophenyl)pyrazole is sourced from PubChem (CID 119039085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).