About methyl 3-[4-[2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanoyl]piperazin-1-yl]butanoate
methyl 3-[4-[2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanoyl]piperazin-1-yl]butanoate (PubChem CID 119039106) has the molecular formula C22H31N3O5
and a molecular weight of 417.51 g/mol. Its IUPAC name is methyl 3-[4-[2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanoyl]piperazin-1-yl]butanoate.
Molecular Properties
| Compound Name | methyl 3-[4-[2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanoyl]piperazin-1-yl]butanoate |
| PubChem CID | 119039106 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | methyl 3-[4-[2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanoyl]piperazin-1-yl]butanoate |
| SMILES | COC(=O)CC(C)N1CCN(C(=O)C(Cc2ccccc2)N2CCCOC2=O)CC1 |
| InChI | InChI=1S/C22H31N3O5/c1-17(15-20(26)29-2)23-10-12-24(13-11-23)21(27)19(16-18-7-4-3-5-8-18)25-9-6-14-30-22(25)28/h3-5,7-8,17,19H,6,9-16H2,1-2H3 |
| InChIKey | QUVRZBWXEVAEGU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[4-[2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanoyl]piperazin-1-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-[2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanoyl]piperazin-1-yl]butanoate?
The IUPAC name of methyl 3-[4-[2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanoyl]piperazin-1-yl]butanoate (CID 119039106) is methyl 3-[4-[2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanoyl]piperazin-1-yl]butanoate.
What is the SMILES notation for methyl 3-[4-[2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanoyl]piperazin-1-yl]butanoate?
The canonical SMILES for methyl 3-[4-[2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanoyl]piperazin-1-yl]butanoate is COC(=O)CC(C)N1CCN(C(=O)C(Cc2ccccc2)N2CCCOC2=O)CC1.
What is the InChIKey of methyl 3-[4-[2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanoyl]piperazin-1-yl]butanoate?
The InChIKey is QUVRZBWXEVAEGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31N3O5/c1-17(15-20(26)29-2)23-10-12-24(13-11-23)21(27)19(16-18-7-4-3-5-8-18)25-9-6-14-30-22(25)28/h3-5,7-8,17,19H,6,9-16H2,1-2H3.
What are the key properties of methyl 3-[4-[2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanoyl]piperazin-1-yl]butanoate?
methyl 3-[4-[2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanoyl]piperazin-1-yl]butanoate has a molecular weight of 417.51 g/mol, XLogP of 1.54, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-[2-(2-oxo-1,3-oxazinan-3-yl)-3-phenylpropanoyl]piperazin-1-yl]butanoate is sourced from PubChem (CID 119039106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).