C20H21N5O2 — CID 119039409
N-(4-phenoxyphenyl)-2-[3-(1,2,4-triazol-1-yl)pyrrolidin-1-yl]acetamide (PubChem CID 119039409) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-(4-phenoxyphenyl)-2-[3-(1,2,4-triazol-1-yl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-(4-phenoxyphenyl)-2-[3-(1,2,4-triazol-1-yl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 119039409 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N-(4-phenoxyphenyl)-2-[3-(1,2,4-triazol-1-yl)pyrrolidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC(n2cncn2)C1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C20H21N5O2/c26-20(13-24-11-10-17(12-24)25-15-21-14-22-25)23-16-6-8-19(9-7-16)27-18-4-2-1-3-5-18/h1-9,14-15,17H,10-13H2,(H,23,26) |
| InChIKey | HGIXRAYLALQBTE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |