C13H25N3O3S — CID 119040378
N-(3-methylcyclopentyl)-4-(sulfamoylmethyl)piperidine-1-carboxamide (PubChem CID 119040378) has the molecular formula C13H25N3O3S and a molecular weight of 303.43 g/mol. Its IUPAC name is N-(3-methylcyclopentyl)-4-(sulfamoylmethyl)piperidine-1-carboxamide.
| Compound Name | N-(3-methylcyclopentyl)-4-(sulfamoylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 119040378 |
| Molecular Formula | C13H25N3O3S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-(3-methylcyclopentyl)-4-(sulfamoylmethyl)piperidine-1-carboxamide |
| SMILES | CC1CCC(NC(=O)N2CCC(CS(N)(=O)=O)CC2)C1 |
| InChI | InChI=1S/C13H25N3O3S/c1-10-2-3-12(8-10)15-13(17)16-6-4-11(5-7-16)9-20(14,18)19/h10-12H,2-9H2,1H3,(H,15,17)(H2,14,18,19) |
| InChIKey | UEDYRMIKPYMYEU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |