About N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3-(1-methyltetrazol-5-yl)sulfanyl-N-propylpropanamide
N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3-(1-methyltetrazol-5-yl)sulfanyl-N-propylpropanamide (PubChem CID 119040477) has the molecular formula C13H20N6O3S
and a molecular weight of 340.41 g/mol. Its IUPAC name is N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3-(1-methyltetrazol-5-yl)sulfanyl-N-propylpropanamide.
Molecular Properties
| Compound Name | N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3-(1-methyltetrazol-5-yl)sulfanyl-N-propylpropanamide |
| PubChem CID | 119040477 |
| Molecular Formula | C13H20N6O3S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3-(1-methyltetrazol-5-yl)sulfanyl-N-propylpropanamide |
| SMILES | CCCN(C(=O)CCSc1nnnn1C)C1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C13H20N6O3S/c1-4-6-19(9-8-11(21)17(2)12(9)22)10(20)5-7-23-13-14-15-16-18(13)3/h9H,4-8H2,1-3H3 |
| InChIKey | GWXYYMUPTQGWST-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3-(1-methyltetrazol-5-yl)sulfanyl-N-propylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3-(1-methyltetrazol-5-yl)sulfanyl-N-propylpropanamide?
The IUPAC name of N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3-(1-methyltetrazol-5-yl)sulfanyl-N-propylpropanamide (CID 119040477) is N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3-(1-methyltetrazol-5-yl)sulfanyl-N-propylpropanamide.
What is the SMILES notation for N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3-(1-methyltetrazol-5-yl)sulfanyl-N-propylpropanamide?
The canonical SMILES for N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3-(1-methyltetrazol-5-yl)sulfanyl-N-propylpropanamide is CCCN(C(=O)CCSc1nnnn1C)C1CC(=O)N(C)C1=O.
What is the InChIKey of N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3-(1-methyltetrazol-5-yl)sulfanyl-N-propylpropanamide?
The InChIKey is GWXYYMUPTQGWST-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N6O3S/c1-4-6-19(9-8-11(21)17(2)12(9)22)10(20)5-7-23-13-14-15-16-18(13)3/h9H,4-8H2,1-3H3.
What are the key properties of N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3-(1-methyltetrazol-5-yl)sulfanyl-N-propylpropanamide?
N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3-(1-methyltetrazol-5-yl)sulfanyl-N-propylpropanamide has a molecular weight of 340.41 g/mol, XLogP of -0.31, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-3-(1-methyltetrazol-5-yl)sulfanyl-N-propylpropanamide is sourced from PubChem (CID 119040477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).