C14H14ClN3O3 — CID 119040538
methyl 4-[[2-(4-chlorophenyl)-2-hydroxyethyl]amino]pyrimidine-5-carboxylate (PubChem CID 119040538) has the molecular formula C14H14ClN3O3 and a molecular weight of 307.74 g/mol. Its IUPAC name is methyl 4-[[2-(4-chlorophenyl)-2-hydroxyethyl]amino]pyrimidine-5-carboxylate.
| Compound Name | methyl 4-[[2-(4-chlorophenyl)-2-hydroxyethyl]amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 119040538 |
| Molecular Formula | C14H14ClN3O3 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | methyl 4-[[2-(4-chlorophenyl)-2-hydroxyethyl]amino]pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cncnc1NCC(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H14ClN3O3/c1-21-14(20)11-6-16-8-18-13(11)17-7-12(19)9-2-4-10(15)5-3-9/h2-6,8,12,19H,7H2,1H3,(H,16,17,18) |
| InChIKey | LDJVQHJORVSAHT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |