C22H21NO3 — CID 11904086
(3aR,4R,9bS)-4-(4-prop-2-enoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylic acid (PubChem CID 11904086) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is (3aR,4R,9bS)-4-(4-prop-2-enoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylic acid.
| Compound Name | (3aR,4R,9bS)-4-(4-prop-2-enoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 11904086 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (3aR,4R,9bS)-4-(4-prop-2-enoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylic acid |
| SMILES | C=CCOc1ccc([C@@H]2Nc3ccc(C(=O)O)cc3[C@H]3C=CC[C@H]32)cc1 |
| InChI | InChI=1S/C22H21NO3/c1-2-12-26-16-9-6-14(7-10-16)21-18-5-3-4-17(18)19-13-15(22(24)25)8-11-20(19)23-21/h2-4,6-11,13,17-18,21,23H,1,5,12H2,(H,24,25)/t17-,18+,21-/m0/s1 |
| InChIKey | SHVMYTQKYXOYAT-UEXGIBASSA-N |
| XLogP | 4.78 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|