About N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-(trifluoromethyl)-7H-purin-6-amine
N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-(trifluoromethyl)-7H-purin-6-amine (PubChem CID 119041070) has the molecular formula C12H11F3N6O
and a molecular weight of 312.26 g/mol. Its IUPAC name is N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-(trifluoromethyl)-7H-purin-6-amine.
Molecular Properties
| Compound Name | N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-(trifluoromethyl)-7H-purin-6-amine |
| PubChem CID | 119041070 |
| Molecular Formula | C12H11F3N6O |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-(trifluoromethyl)-7H-purin-6-amine |
| SMILES | Cc1cc(CN(C)c2nc(C(F)(F)F)nc3nc[nH]c23)no1 |
| InChI | InChI=1S/C12H11F3N6O/c1-6-3-7(20-22-6)4-21(2)10-8-9(17-5-16-8)18-11(19-10)12(13,14)15/h3,5H,4H2,1-2H3,(H,16,17,18,19) |
| InChIKey | FXXUYNZNVQGQLI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-(trifluoromethyl)-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-(trifluoromethyl)-7H-purin-6-amine?
The IUPAC name of N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-(trifluoromethyl)-7H-purin-6-amine (CID 119041070) is N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-(trifluoromethyl)-7H-purin-6-amine.
What is the SMILES notation for N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-(trifluoromethyl)-7H-purin-6-amine?
The canonical SMILES for N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-(trifluoromethyl)-7H-purin-6-amine is Cc1cc(CN(C)c2nc(C(F)(F)F)nc3nc[nH]c23)no1.
What is the InChIKey of N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-(trifluoromethyl)-7H-purin-6-amine?
The InChIKey is FXXUYNZNVQGQLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N6O/c1-6-3-7(20-22-6)4-21(2)10-8-9(17-5-16-8)18-11(19-10)12(13,14)15/h3,5H,4H2,1-2H3,(H,16,17,18,19).
What are the key properties of N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-(trifluoromethyl)-7H-purin-6-amine?
N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-(trifluoromethyl)-7H-purin-6-amine has a molecular weight of 312.26 g/mol, XLogP of 2.30, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-(trifluoromethyl)-7H-purin-6-amine is sourced from PubChem (CID 119041070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).