C17H24NO3P — CID 11904215
N-[1-adamantyloxy(phenoxy)phosphoryl]methanamine (PubChem CID 11904215) has the molecular formula C17H24NO3P and a molecular weight of 321.36 g/mol. Its IUPAC name is N-[1-adamantyloxy(phenoxy)phosphoryl]methanamine.
| Compound Name | N-[1-adamantyloxy(phenoxy)phosphoryl]methanamine |
|---|---|
| PubChem CID | 11904215 |
| Molecular Formula | C17H24NO3P |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-[1-adamantyloxy(phenoxy)phosphoryl]methanamine |
| SMILES | CN[P@@](=O)(Oc1ccccc1)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H24NO3P/c1-18-22(19,20-16-5-3-2-4-6-16)21-17-10-13-7-14(11-17)9-15(8-13)12-17/h2-6,13-15H,7-12H2,1H3,(H,18,19)/t13?,14?,15?,17?,22-/m1/s1 |
| InChIKey | DBUAJLPJJLNVRX-FCXUEDCTSA-N |
| XLogP | 4.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|