C19H22N2O3 — CID 119042263
3-[3-[(4-ethylphenyl)methylamino]-3-oxopropoxy]benzamide (PubChem CID 119042263) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-[3-[(4-ethylphenyl)methylamino]-3-oxopropoxy]benzamide.
| Compound Name | 3-[3-[(4-ethylphenyl)methylamino]-3-oxopropoxy]benzamide |
|---|---|
| PubChem CID | 119042263 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 3-[3-[(4-ethylphenyl)methylamino]-3-oxopropoxy]benzamide |
| SMILES | CCc1ccc(CNC(=O)CCOc2cccc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C19H22N2O3/c1-2-14-6-8-15(9-7-14)13-21-18(22)10-11-24-17-5-3-4-16(12-17)19(20)23/h3-9,12H,2,10-11,13H2,1H3,(H2,20,23)(H,21,22) |
| InChIKey | SCICTPJCZRQKOS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |