About N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide
N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide (PubChem CID 119043080) has the molecular formula C11H10F2N4O2
and a molecular weight of 268.22 g/mol. Its IUPAC name is N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide |
| PubChem CID | 119043080 |
| Molecular Formula | C11H10F2N4O2 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cccc(OCC(F)F)n1)c1ccn[nH]1 |
| InChI | InChI=1S/C11H10F2N4O2/c12-8(13)6-19-10-3-1-2-9(15-10)16-11(18)7-4-5-14-17-7/h1-5,8H,6H2,(H,14,17)(H,15,16,18) |
| InChIKey | KZNVHJZAZGWPJX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide?
The IUPAC name of N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide (CID 119043080) is N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide.
What is the SMILES notation for N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide?
The canonical SMILES for N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide is O=C(Nc1cccc(OCC(F)F)n1)c1ccn[nH]1.
What is the InChIKey of N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide?
The InChIKey is KZNVHJZAZGWPJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2N4O2/c12-8(13)6-19-10-3-1-2-9(15-10)16-11(18)7-4-5-14-17-7/h1-5,8H,6H2,(H,14,17)(H,15,16,18).
What are the key properties of N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide?
N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide has a molecular weight of 268.22 g/mol, XLogP of 1.70, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide is sourced from PubChem (CID 119043080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).