C11H10F2N4O2 — CID 119043080
N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide (PubChem CID 119043080) has the molecular formula C11H10F2N4O2 and a molecular weight of 268.22 g/mol. Its IUPAC name is N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 119043080 |
| Molecular Formula | C11H10F2N4O2 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-[6-(2,2-difluoroethoxy)-2-pyridinyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cccc(OCC(F)F)n1)c1ccn[nH]1 |
| InChI | InChI=1S/C11H10F2N4O2/c12-8(13)6-19-10-3-1-2-9(15-10)16-11(18)7-4-5-14-17-7/h1-5,8H,6H2,(H,14,17)(H,15,16,18) |
| InChIKey | KZNVHJZAZGWPJX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |