C15H14ClFN2O4S — CID 119044636
N-[(4-chloro-3-fluorophenyl)methylsulfonyl]-6-ethoxypyridine-3-carboxamide (PubChem CID 119044636) has the molecular formula C15H14ClFN2O4S and a molecular weight of 372.81 g/mol. Its IUPAC name is N-[(4-chloro-3-fluorophenyl)methylsulfonyl]-6-ethoxypyridine-3-carboxamide.
| Compound Name | N-[(4-chloro-3-fluorophenyl)methylsulfonyl]-6-ethoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 119044636 |
| Molecular Formula | C15H14ClFN2O4S |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | N-[(4-chloro-3-fluorophenyl)methylsulfonyl]-6-ethoxypyridine-3-carboxamide |
| SMILES | CCOc1ccc(C(=O)NS(=O)(=O)Cc2ccc(Cl)c(F)c2)cn1 |
| InChI | InChI=1S/C15H14ClFN2O4S/c1-2-23-14-6-4-11(8-18-14)15(20)19-24(21,22)9-10-3-5-12(16)13(17)7-10/h3-8H,2,9H2,1H3,(H,19,20) |
| InChIKey | RUSAOYQKKNFFHL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |