C14H14ClNO3S — CID 119045553
N-(5-chloro-2-methylphenyl)-2-(2-methylfuran-3-yl)sulfinylacetamide (PubChem CID 119045553) has the molecular formula C14H14ClNO3S and a molecular weight of 311.79 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-(2-methylfuran-3-yl)sulfinylacetamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-(2-methylfuran-3-yl)sulfinylacetamide |
|---|---|
| PubChem CID | 119045553 |
| Molecular Formula | C14H14ClNO3S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-(2-methylfuran-3-yl)sulfinylacetamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CS(=O)c1ccoc1C |
| InChI | InChI=1S/C14H14ClNO3S/c1-9-3-4-11(15)7-12(9)16-14(17)8-20(18)13-5-6-19-10(13)2/h3-7H,8H2,1-2H3,(H,16,17) |
| InChIKey | IVEDWLDOTQRMHI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |