C22H32N4O2 — CID 119046468
1-methyl-N-[[1-(3-phenylmethoxybutyl)piperidin-4-yl]methyl]pyrazole-4-carboxamide (PubChem CID 119046468) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-methyl-N-[[1-(3-phenylmethoxybutyl)piperidin-4-yl]methyl]pyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-[[1-(3-phenylmethoxybutyl)piperidin-4-yl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 119046468 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 1-methyl-N-[[1-(3-phenylmethoxybutyl)piperidin-4-yl]methyl]pyrazole-4-carboxamide |
| SMILES | CC(CCN1CCC(CNC(=O)c2cnn(C)c2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C22H32N4O2/c1-18(28-17-20-6-4-3-5-7-20)8-11-26-12-9-19(10-13-26)14-23-22(27)21-15-24-25(2)16-21/h3-7,15-16,18-19H,8-14,17H2,1-2H3,(H,23,27) |
| InChIKey | NMHSTOKTHAKNOA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |