C19H16N4O2 — CID 119046904
(2Z)-2-(2,3-dihydrochromen-4-ylidene)-N-(4-phenyl-1,2,4-triazol-3-yl)acetamide (PubChem CID 119046904) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is (2Z)-2-(2,3-dihydrochromen-4-ylidene)-N-(4-phenyl-1,2,4-triazol-3-yl)acetamide.
| Compound Name | (2Z)-2-(2,3-dihydrochromen-4-ylidene)-N-(4-phenyl-1,2,4-triazol-3-yl)acetamide |
|---|---|
| PubChem CID | 119046904 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (2Z)-2-(2,3-dihydrochromen-4-ylidene)-N-(4-phenyl-1,2,4-triazol-3-yl)acetamide |
| SMILES | O=C(/C=C1/CCOc2ccccc21)Nc1nncn1-c1ccccc1 |
| InChI | InChI=1S/C19H16N4O2/c24-18(12-14-10-11-25-17-9-5-4-8-16(14)17)21-19-22-20-13-23(19)15-6-2-1-3-7-15/h1-9,12-13H,10-11H2,(H,21,22,24)/b14-12- |
| InChIKey | FQQRGNZXBSYKSQ-OWBHPGMISA-N |
| XLogP | 3.07 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|