C16H21F5N2O2 — CID 119047188
N-[2-(N-methylanilino)propyl]-3-(2,2,3,3,3-pentafluoropropoxy)propanamide (PubChem CID 119047188) has the molecular formula C16H21F5N2O2 and a molecular weight of 368.35 g/mol. Its IUPAC name is N-[2-(N-methylanilino)propyl]-3-(2,2,3,3,3-pentafluoropropoxy)propanamide.
| Compound Name | N-[2-(N-methylanilino)propyl]-3-(2,2,3,3,3-pentafluoropropoxy)propanamide |
|---|---|
| PubChem CID | 119047188 |
| Molecular Formula | C16H21F5N2O2 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-[2-(N-methylanilino)propyl]-3-(2,2,3,3,3-pentafluoropropoxy)propanamide |
| SMILES | CC(CNC(=O)CCOCC(F)(F)C(F)(F)F)N(C)c1ccccc1 |
| InChI | InChI=1S/C16H21F5N2O2/c1-12(23(2)13-6-4-3-5-7-13)10-22-14(24)8-9-25-11-15(17,18)16(19,20)21/h3-7,12H,8-11H2,1-2H3,(H,22,24) |
| InChIKey | BSULYIPKRAWGDX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|