C20H20ClN3O3 — CID 119047574
4-chloro-N-methyl-3-[[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]carbamoylamino]benzamide (PubChem CID 119047574) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is 4-chloro-N-methyl-3-[[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]carbamoylamino]benzamide.
| Compound Name | 4-chloro-N-methyl-3-[[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 119047574 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-chloro-N-methyl-3-[[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]carbamoylamino]benzamide |
| SMILES | CNC(=O)c1ccc(Cl)c(NC(=O)N[C@@H](C)c2oc3ccccc3c2C)c1 |
| InChI | InChI=1S/C20H20ClN3O3/c1-11-14-6-4-5-7-17(14)27-18(11)12(2)23-20(26)24-16-10-13(19(25)22-3)8-9-15(16)21/h4-10,12H,1-3H3,(H,22,25)(H2,23,24,26)/t12-/m0/s1 |
| InChIKey | NOZVWDXFJACEOU-LBPRGKRZSA-N |
| XLogP | 4.64 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |