C16H24NO+ — CID 11904775
4-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]phenol (PubChem CID 11904775) has the molecular formula C16H24NO+ and a molecular weight of 246.37 g/mol. Its IUPAC name is 4-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]phenol.
| Compound Name | 4-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 11904775 |
| Molecular Formula | C16H24NO+ |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 4-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]phenol |
| SMILES | Oc1ccc(C[NH+]2CCC[C@@H]3CCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C16H23NO/c18-15-9-7-13(8-10-15)12-17-11-3-5-14-4-1-2-6-16(14)17/h7-10,14,16,18H,1-6,11-12H2/p+1/t14-,16-/m0/s1 |
| InChIKey | LPZZGKAOEYRCGK-HOCLYGCPSA-O |
| XLogP | 2.13 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |