About 5-[(7-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]thiophene-2-carbonitrile
5-[(7-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]thiophene-2-carbonitrile (PubChem CID 119049388) has the molecular formula C12H16N2O2S2
and a molecular weight of 284.41 g/mol. Its IUPAC name is 5-[(7-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]thiophene-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[(7-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]thiophene-2-carbonitrile |
| PubChem CID | 119049388 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 5-[(7-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]thiophene-2-carbonitrile |
| SMILES | CC1CCN(Cc2ccc(C#N)s2)CCS1(=O)=O |
| InChI | InChI=1S/C12H16N2O2S2/c1-10-4-5-14(6-7-18(10,15)16)9-12-3-2-11(8-13)17-12/h2-3,10H,4-7,9H2,1H3 |
| InChIKey | RHKPRRSHSJUGLV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(7-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]thiophene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(7-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]thiophene-2-carbonitrile?
The IUPAC name of 5-[(7-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]thiophene-2-carbonitrile (CID 119049388) is 5-[(7-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]thiophene-2-carbonitrile.
What is the SMILES notation for 5-[(7-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]thiophene-2-carbonitrile?
The canonical SMILES for 5-[(7-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]thiophene-2-carbonitrile is CC1CCN(Cc2ccc(C#N)s2)CCS1(=O)=O.
What is the InChIKey of 5-[(7-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]thiophene-2-carbonitrile?
The InChIKey is RHKPRRSHSJUGLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2S2/c1-10-4-5-14(6-7-18(10,15)16)9-12-3-2-11(8-13)17-12/h2-3,10H,4-7,9H2,1H3.
What are the key properties of 5-[(7-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]thiophene-2-carbonitrile?
5-[(7-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]thiophene-2-carbonitrile has a molecular weight of 284.41 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(7-methyl-1,1-dioxo-1,4-thiazepan-4-yl)methyl]thiophene-2-carbonitrile is sourced from PubChem (CID 119049388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).