C17H25ClN2O2 — CID 119050461
methyl 2-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]butanoate (PubChem CID 119050461) has the molecular formula C17H25ClN2O2 and a molecular weight of 324.85 g/mol. Its IUPAC name is methyl 2-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]butanoate.
| Compound Name | methyl 2-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]butanoate |
|---|---|
| PubChem CID | 119050461 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | methyl 2-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]butanoate |
| SMILES | CCC(NC1CCN(Cc2ccc(Cl)cc2)CC1)C(=O)OC |
| InChI | InChI=1S/C17H25ClN2O2/c1-3-16(17(21)22-2)19-15-8-10-20(11-9-15)12-13-4-6-14(18)7-5-13/h4-7,15-16,19H,3,8-12H2,1-2H3 |
| InChIKey | YIDIIULAJJPEDO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |