About N-(2,2-difluoroethyl)-2-(8-tricyclo[5.2.1.02,6]decanylamino)acetamide
N-(2,2-difluoroethyl)-2-(8-tricyclo[5.2.1.02,6]decanylamino)acetamide (PubChem CID 119050715) has the molecular formula C14H22F2N2O
and a molecular weight of 272.34 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-(8-tricyclo[5.2.1.02,6]decanylamino)acetamide.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)-2-(8-tricyclo[5.2.1.02,6]decanylamino)acetamide |
| PubChem CID | 119050715 |
| Molecular Formula | C14H22F2N2O |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-(8-tricyclo[5.2.1.02,6]decanylamino)acetamide |
| SMILES | O=C(CNC1CC2CC1C1CCCC21)NCC(F)F |
| InChI | InChI=1S/C14H22F2N2O/c15-13(16)6-18-14(19)7-17-12-5-8-4-11(12)10-3-1-2-9(8)10/h8-13,17H,1-7H2,(H,18,19) |
| InChIKey | ZHPGHYBTGZPEIB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,2-difluoroethyl)-2-(8-tricyclo[5.2.1.02,6]decanylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-2-(8-tricyclo[5.2.1.02,6]decanylamino)acetamide?
The IUPAC name of N-(2,2-difluoroethyl)-2-(8-tricyclo[5.2.1.02,6]decanylamino)acetamide (CID 119050715) is N-(2,2-difluoroethyl)-2-(8-tricyclo[5.2.1.02,6]decanylamino)acetamide.
What is the SMILES notation for N-(2,2-difluoroethyl)-2-(8-tricyclo[5.2.1.02,6]decanylamino)acetamide?
The canonical SMILES for N-(2,2-difluoroethyl)-2-(8-tricyclo[5.2.1.02,6]decanylamino)acetamide is O=C(CNC1CC2CC1C1CCCC21)NCC(F)F.
What is the InChIKey of N-(2,2-difluoroethyl)-2-(8-tricyclo[5.2.1.02,6]decanylamino)acetamide?
The InChIKey is ZHPGHYBTGZPEIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F2N2O/c15-13(16)6-18-14(19)7-17-12-5-8-4-11(12)10-3-1-2-9(8)10/h8-13,17H,1-7H2,(H,18,19).
What are the key properties of N-(2,2-difluoroethyl)-2-(8-tricyclo[5.2.1.02,6]decanylamino)acetamide?
N-(2,2-difluoroethyl)-2-(8-tricyclo[5.2.1.02,6]decanylamino)acetamide has a molecular weight of 272.34 g/mol, XLogP of 1.78, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-2-(8-tricyclo[5.2.1.02,6]decanylamino)acetamide is sourced from PubChem (CID 119050715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).