C17H23FN2O3 — CID 119051038
1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-hex-5-en-3-ylurea (PubChem CID 119051038) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-hex-5-en-3-ylurea.
| Compound Name | 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-hex-5-en-3-ylurea |
|---|---|
| PubChem CID | 119051038 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-hex-5-en-3-ylurea |
| SMILES | C=CCC(CC)NC(=O)NCCc1cc(F)cc2c1OCOC2 |
| InChI | InChI=1S/C17H23FN2O3/c1-3-5-15(4-2)20-17(21)19-7-6-12-8-14(18)9-13-10-22-11-23-16(12)13/h3,8-9,15H,1,4-7,10-11H2,2H3,(H2,19,20,21) |
| InChIKey | GZABWCJLNVHUMD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|