About methyl 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-thiophen-3-ylacetate
methyl 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-thiophen-3-ylacetate (PubChem CID 119051080) has the molecular formula C12H14N2O3S2
and a molecular weight of 298.39 g/mol. Its IUPAC name is methyl 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-thiophen-3-ylacetate.
Molecular Properties
| Compound Name | methyl 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-thiophen-3-ylacetate |
| PubChem CID | 119051080 |
| Molecular Formula | C12H14N2O3S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | methyl 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-thiophen-3-ylacetate |
| SMILES | CCCc1nnc(SC(C(=O)OC)c2ccsc2)o1 |
| InChI | InChI=1S/C12H14N2O3S2/c1-3-4-9-13-14-12(17-9)19-10(11(15)16-2)8-5-6-18-7-8/h5-7,10H,3-4H2,1-2H3 |
| InChIKey | JNLPUFYKAXJYKV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-thiophen-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-thiophen-3-ylacetate?
The IUPAC name of methyl 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-thiophen-3-ylacetate (CID 119051080) is methyl 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-thiophen-3-ylacetate.
What is the SMILES notation for methyl 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-thiophen-3-ylacetate?
The canonical SMILES for methyl 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-thiophen-3-ylacetate is CCCc1nnc(SC(C(=O)OC)c2ccsc2)o1.
What is the InChIKey of methyl 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-thiophen-3-ylacetate?
The InChIKey is JNLPUFYKAXJYKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3S2/c1-3-4-9-13-14-12(17-9)19-10(11(15)16-2)8-5-6-18-7-8/h5-7,10H,3-4H2,1-2H3.
What are the key properties of methyl 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-thiophen-3-ylacetate?
methyl 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-thiophen-3-ylacetate has a molecular weight of 298.39 g/mol, XLogP of 3.09, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(5-propyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-thiophen-3-ylacetate is sourced from PubChem (CID 119051080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).