C9H13F3N2O2 — CID 119051597
5,5-dimethyl-4-(3,3,3-trifluoropropanoyl)piperazin-2-one (PubChem CID 119051597) has the molecular formula C9H13F3N2O2 and a molecular weight of 238.21 g/mol. Its IUPAC name is 5,5-dimethyl-4-(3,3,3-trifluoropropanoyl)piperazin-2-one.
| Compound Name | 5,5-dimethyl-4-(3,3,3-trifluoropropanoyl)piperazin-2-one |
|---|---|
| PubChem CID | 119051597 |
| Molecular Formula | C9H13F3N2O2 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 5,5-dimethyl-4-(3,3,3-trifluoropropanoyl)piperazin-2-one |
| SMILES | CC1(C)CNC(=O)CN1C(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O2/c1-8(2)5-13-6(15)4-14(8)7(16)3-9(10,11)12/h3-5H2,1-2H3,(H,13,15) |
| InChIKey | NIJGYRAEBCXPKT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |