C15H17ClN4O3 — CID 119052107
4-chloro-N-[2-[[2-hydroxy-2-(1-methylpyrazol-4-yl)acetyl]amino]ethyl]benzamide (PubChem CID 119052107) has the molecular formula C15H17ClN4O3 and a molecular weight of 336.78 g/mol. Its IUPAC name is 4-chloro-N-[2-[[2-hydroxy-2-(1-methylpyrazol-4-yl)acetyl]amino]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[[2-hydroxy-2-(1-methylpyrazol-4-yl)acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 119052107 |
| Molecular Formula | C15H17ClN4O3 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 4-chloro-N-[2-[[2-hydroxy-2-(1-methylpyrazol-4-yl)acetyl]amino]ethyl]benzamide |
| SMILES | Cn1cc(C(O)C(=O)NCCNC(=O)c2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C15H17ClN4O3/c1-20-9-11(8-19-20)13(21)15(23)18-7-6-17-14(22)10-2-4-12(16)5-3-10/h2-5,8-9,13,21H,6-7H2,1H3,(H,17,22)(H,18,23) |
| InChIKey | FBVNTOHUQKWBPC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|