C13H18F3N3O3S — CID 119052310
2-(5,7-dioxo-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-6-yl)-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 119052310) has the molecular formula C13H18F3N3O3S and a molecular weight of 353.37 g/mol. Its IUPAC name is 2-(5,7-dioxo-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-6-yl)-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(5,7-dioxo-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-6-yl)-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 119052310 |
| Molecular Formula | C13H18F3N3O3S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-(5,7-dioxo-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-6-yl)-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CC(C)CN(CC(F)(F)F)C(=O)CN1C(=O)C2CSCN2C1=O |
| InChI | InChI=1S/C13H18F3N3O3S/c1-8(2)3-17(6-13(14,15)16)10(20)4-18-11(21)9-5-23-7-19(9)12(18)22/h8-9H,3-7H2,1-2H3 |
| InChIKey | NDQMDVSPKFNJEL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|