About 5-(2-cyclopentylethoxy)-1,3,4-trimethylpyrazole
5-(2-cyclopentylethoxy)-1,3,4-trimethylpyrazole (PubChem CID 119052331) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is 5-(2-cyclopentylethoxy)-1,3,4-trimethylpyrazole.
Molecular Properties
| Compound Name | 5-(2-cyclopentylethoxy)-1,3,4-trimethylpyrazole |
| PubChem CID | 119052331 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 5-(2-cyclopentylethoxy)-1,3,4-trimethylpyrazole |
| SMILES | Cc1nn(C)c(OCCC2CCCC2)c1C |
| InChI | InChI=1S/C13H22N2O/c1-10-11(2)14-15(3)13(10)16-9-8-12-6-4-5-7-12/h12H,4-9H2,1-3H3 |
| InChIKey | GNPHLQFCSJAQOK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2-cyclopentylethoxy)-1,3,4-trimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-cyclopentylethoxy)-1,3,4-trimethylpyrazole?
The IUPAC name of 5-(2-cyclopentylethoxy)-1,3,4-trimethylpyrazole (CID 119052331) is 5-(2-cyclopentylethoxy)-1,3,4-trimethylpyrazole.
What is the SMILES notation for 5-(2-cyclopentylethoxy)-1,3,4-trimethylpyrazole?
The canonical SMILES for 5-(2-cyclopentylethoxy)-1,3,4-trimethylpyrazole is Cc1nn(C)c(OCCC2CCCC2)c1C.
What is the InChIKey of 5-(2-cyclopentylethoxy)-1,3,4-trimethylpyrazole?
The InChIKey is GNPHLQFCSJAQOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O/c1-10-11(2)14-15(3)13(10)16-9-8-12-6-4-5-7-12/h12H,4-9H2,1-3H3.
What are the key properties of 5-(2-cyclopentylethoxy)-1,3,4-trimethylpyrazole?
5-(2-cyclopentylethoxy)-1,3,4-trimethylpyrazole has a molecular weight of 222.33 g/mol, XLogP of 3.00, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-cyclopentylethoxy)-1,3,4-trimethylpyrazole is sourced from PubChem (CID 119052331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).