C13H20N4 — CID 119052584
N-(4-methylcyclohex-3-en-1-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 119052584) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is N-(4-methylcyclohex-3-en-1-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | N-(4-methylcyclohex-3-en-1-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 119052584 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | N-(4-methylcyclohex-3-en-1-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | CC1=CCC(NC2CCCn3ncnc32)CC1 |
| InChI | InChI=1S/C13H20N4/c1-10-4-6-11(7-5-10)16-12-3-2-8-17-13(12)14-9-15-17/h4,9,11-12,16H,2-3,5-8H2,1H3 |
| InChIKey | ZDUDSLQDDVRZIX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|