C11H12F2N2O4S — CID 119052693
2-[2-(2,2-difluoroethoxy)ethyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 119052693) has the molecular formula C11H12F2N2O4S and a molecular weight of 306.29 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 119052693 |
| Molecular Formula | C11H12F2N2O4S |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | O=C1Nc2ccccc2S(=O)(=O)N1CCOCC(F)F |
| InChI | InChI=1S/C11H12F2N2O4S/c12-10(13)7-19-6-5-15-11(16)14-8-3-1-2-4-9(8)20(15,17)18/h1-4,10H,5-7H2,(H,14,16) |
| InChIKey | XFTJQTMWPLWIQE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|