About N-[4-(furan-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-8-yl]furan-3-carboxamide
N-[4-(furan-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-8-yl]furan-3-carboxamide (PubChem CID 119052873) has the molecular formula C18H14N2O5
and a molecular weight of 338.32 g/mol. Its IUPAC name is N-[4-(furan-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-8-yl]furan-3-carboxamide.
Molecular Properties
| Compound Name | N-[4-(furan-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-8-yl]furan-3-carboxamide |
| PubChem CID | 119052873 |
| Molecular Formula | C18H14N2O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N-[4-(furan-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-8-yl]furan-3-carboxamide |
| SMILES | O=C(Nc1cccc2c1OCCN2C(=O)c1ccoc1)c1ccoc1 |
| InChI | InChI=1S/C18H14N2O5/c21-17(12-4-7-23-10-12)19-14-2-1-3-15-16(14)25-9-6-20(15)18(22)13-5-8-24-11-13/h1-5,7-8,10-11H,6,9H2,(H,19,21) |
| InChIKey | ZIDOZDSMFTZGQH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-(furan-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-8-yl]furan-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(furan-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-8-yl]furan-3-carboxamide?
The IUPAC name of N-[4-(furan-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-8-yl]furan-3-carboxamide (CID 119052873) is N-[4-(furan-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-8-yl]furan-3-carboxamide.
What is the SMILES notation for N-[4-(furan-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-8-yl]furan-3-carboxamide?
The canonical SMILES for N-[4-(furan-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-8-yl]furan-3-carboxamide is O=C(Nc1cccc2c1OCCN2C(=O)c1ccoc1)c1ccoc1.
What is the InChIKey of N-[4-(furan-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-8-yl]furan-3-carboxamide?
The InChIKey is ZIDOZDSMFTZGQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O5/c21-17(12-4-7-23-10-12)19-14-2-1-3-15-16(14)25-9-6-20(15)18(22)13-5-8-24-11-13/h1-5,7-8,10-11H,6,9H2,(H,19,21).
What are the key properties of N-[4-(furan-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-8-yl]furan-3-carboxamide?
N-[4-(furan-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-8-yl]furan-3-carboxamide has a molecular weight of 338.32 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(furan-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-8-yl]furan-3-carboxamide is sourced from PubChem (CID 119052873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).